C16H17N3O5S — CID 173007462
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[5-(hydroxyiminomethyl)thiophen-2-yl]benzamide (PubChem CID 173007462) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[5-(hydroxyiminomethyl)thiophen-2-yl]benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[5-(hydroxyiminomethyl)thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 173007462 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[5-(hydroxyiminomethyl)thiophen-2-yl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(-c2ccc(C=NO)s2)cc1)C(=O)NO |
| InChI | InChI=1S/C16H17N3O5S/c1-9(20)14(16(22)19-24)18-15(21)11-4-2-10(3-5-11)13-7-6-12(25-13)8-17-23/h2-9,14,20,23-24H,1H3,(H,18,21)(H,19,22)/t9-,14+/m1/s1 |
| InChIKey | JPLDRAAHJJXLEH-OTYXRUKQSA-N |
| XLogP | 1.21 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|