C17H17N3O6 — CID 59698158
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(4-nitrophenyl)benzamide (PubChem CID 59698158) has the molecular formula C17H17N3O6 and a molecular weight of 359.34 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(4-nitrophenyl)benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(4-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 59698158 |
| Molecular Formula | C17H17N3O6 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(4-nitrophenyl)benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C17H17N3O6/c1-10(21)15(17(23)19-24)18-16(22)13-4-2-11(3-5-13)12-6-8-14(9-7-12)20(25)26/h2-10,15,21,24H,1H3,(H,18,22)(H,19,23)/t10-,15+/m1/s1 |
| InChIKey | IORIZOYYTXICRF-BMIGLBTASA-N |
| XLogP | 1.25 |
| TPSA | 141.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|