C20H26N4O4 — CID 87199796
4-[3-[(2-aminoethylamino)methyl]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 87199796) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 4-[3-[(2-aminoethylamino)methyl]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[3-[(2-aminoethylamino)methyl]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 87199796 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 4-[3-[(2-aminoethylamino)methyl]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(-c2cccc(CNCCN)c2)cc1)C(=O)NO |
| InChI | InChI=1S/C20H26N4O4/c1-13(25)18(20(27)24-28)23-19(26)16-7-5-15(6-8-16)17-4-2-3-14(11-17)12-22-10-9-21/h2-8,11,13,18,22,25,28H,9-10,12,21H2,1H3,(H,23,26)(H,24,27)/t13-,18+/m1/s1 |
| InChIKey | PCMRKSSUEBXVDK-ACJLOTCBSA-N |
| XLogP | 0.39 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|