C17H18FN3O3 — CID 89048036
N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(3-fluorophenyl)benzamide (PubChem CID 89048036) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(3-fluorophenyl)benzamide.
| Compound Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 89048036 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(3-fluorophenyl)benzamide |
| SMILES | C[C@@H](N)[C@H](NC(=O)c1ccc(-c2cccc(F)c2)cc1)C(=O)NO |
| InChI | InChI=1S/C17H18FN3O3/c1-10(19)15(17(23)21-24)20-16(22)12-7-5-11(6-8-12)13-3-2-4-14(18)9-13/h2-10,15,24H,19H2,1H3,(H,20,22)(H,21,23)/t10-,15+/m1/s1 |
| InChIKey | RNZJPSBZPRVFKF-BMIGLBTASA-N |
| XLogP | 1.44 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|