C20H24N4O5 — CID 87310241
4-[3-[[(2-aminoacetyl)amino]methyl]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 87310241) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[3-[[(2-aminoacetyl)amino]methyl]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[3-[[(2-aminoacetyl)amino]methyl]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 87310241 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-[3-[[(2-aminoacetyl)amino]methyl]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(-c2cccc(CNC(=O)CN)c2)cc1)C(=O)NO |
| InChI | InChI=1S/C20H24N4O5/c1-12(25)18(20(28)24-29)23-19(27)15-7-5-14(6-8-15)16-4-2-3-13(9-16)11-22-17(26)10-21/h2-9,12,18,25,29H,10-11,21H2,1H3,(H,22,26)(H,23,27)(H,24,28)/t12-,18+/m1/s1 |
| InChIKey | FETNTFUJLBONPS-XIKOKIGWSA-N |
| XLogP | -0.09 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|