C20H27N5O3 — CID 88873823
4-[2-[(2-aminoethylamino)methyl]phenyl]-N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 88873823) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-[2-[(2-aminoethylamino)methyl]phenyl]-N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[2-[(2-aminoethylamino)methyl]phenyl]-N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 88873823 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 4-[2-[(2-aminoethylamino)methyl]phenyl]-N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | C[C@@H](N)[C@H](NC(=O)c1ccc(-c2ccccc2CNCCN)cc1)C(=O)NO |
| InChI | InChI=1S/C20H27N5O3/c1-13(22)18(20(27)25-28)24-19(26)15-8-6-14(7-9-15)17-5-3-2-4-16(17)12-23-11-10-21/h2-9,13,18,23,28H,10-12,21-22H2,1H3,(H,24,26)(H,25,27)/t13-,18+/m1/s1 |
| InChIKey | MUOUZWMZAARLKG-ACJLOTCBSA-N |
| XLogP | 0.35 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|