C21H25N5O3 — CID 89048062
N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[(2-cyanoethylamino)methyl]phenyl]benzamide (PubChem CID 89048062) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[(2-cyanoethylamino)methyl]phenyl]benzamide.
| Compound Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[(2-cyanoethylamino)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 89048062 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[(2-cyanoethylamino)methyl]phenyl]benzamide |
| SMILES | C[C@@H](N)[C@H](NC(=O)c1ccc(-c2ccc(CNCCC#N)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C21H25N5O3/c1-14(23)19(21(28)26-29)25-20(27)18-9-7-17(8-10-18)16-5-3-15(4-6-16)13-24-12-2-11-22/h3-10,14,19,24,29H,2,12-13,23H2,1H3,(H,25,27)(H,26,28)/t14-,19+/m1/s1 |
| InChIKey | WJPKOJPMURKPSI-KUHUBIRLSA-N |
| XLogP | 1.31 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|