C21H27FN4O3 — CID 122494434
N-[3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-[(2-fluoroethylamino)methyl]phenyl]benzamide (PubChem CID 122494434) has the molecular formula C21H27FN4O3 and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-[(2-fluoroethylamino)methyl]phenyl]benzamide.
| Compound Name | N-[3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-[(2-fluoroethylamino)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 122494434 |
| Molecular Formula | C21H27FN4O3 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-[(2-fluoroethylamino)methyl]phenyl]benzamide |
| SMILES | CC(C)(N)C(NC(=O)c1ccc(-c2ccc(CNCCF)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C21H27FN4O3/c1-21(2,23)18(20(28)26-29)25-19(27)17-9-7-16(8-10-17)15-5-3-14(4-6-15)13-24-12-11-22/h3-10,18,24,29H,11-13,23H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | GUEZMROUNSZZIZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|