C24H25FN4O3 — CID 87310386
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[(4-fluorophenyl)methylamino]methyl]phenyl]benzamide (PubChem CID 87310386) has the molecular formula C24H25FN4O3 and a molecular weight of 436.49 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[(4-fluorophenyl)methylamino]methyl]phenyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[(4-fluorophenyl)methylamino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 87310386 |
| Molecular Formula | C24H25FN4O3 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[(4-fluorophenyl)methylamino]methyl]phenyl]benzamide |
| SMILES | NC[C@H](NC(=O)c1ccc(-c2ccc(CNCc3ccc(F)cc3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C24H25FN4O3/c25-21-11-3-17(4-12-21)15-27-14-16-1-5-18(6-2-16)19-7-9-20(10-8-19)23(30)28-22(13-26)24(31)29-32/h1-12,22,27,32H,13-15,26H2,(H,28,30)(H,29,31)/t22-/m0/s1 |
| InChIKey | KKJRDOZDEPSLAC-QFIPXVFZSA-N |
| XLogP | 2.35 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|