C30H30FN5O4 — CID 158240610
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-[(4-fluorophenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide;methane (PubChem CID 158240610) has the molecular formula C30H30FN5O4 and a molecular weight of 543.60 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-[(4-fluorophenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide;methane.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-[(4-fluorophenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide;methane |
|---|---|
| PubChem CID | 158240610 |
| Molecular Formula | C30H30FN5O4 |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-[(4-fluorophenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide;methane |
| SMILES | C.NC[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(NC(=O)CNCc3ccc(F)cc3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C29H26FN5O4.CH4/c30-24-13-7-22(8-14-24)18-32-19-27(36)33-25-15-9-21(10-16-25)4-2-1-3-20-5-11-23(12-6-20)28(37)34-26(17-31)29(38)35-39;/h5-16,26,32,39H,17-19,31H2,(H,33,36)(H,34,37)(H,35,38);1H4/t26-;/m0./s1 |
| InChIKey | GFMLAQZSZAPLPO-SNYZSRNZSA-N |
| XLogP | 2.16 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|