C30H29N5O4 — CID 59697204
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-[(3-methylphenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide (PubChem CID 59697204) has the molecular formula C30H29N5O4 and a molecular weight of 523.59 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-[(3-methylphenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-[(3-methylphenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 59697204 |
| Molecular Formula | C30H29N5O4 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-[(3-methylphenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide |
| SMILES | Cc1cccc(CNCC(=O)Nc2ccc(C#CC#Cc3ccc(C(=O)N[C@@H](CN)C(=O)NO)cc3)cc2)c1 |
| InChI | InChI=1S/C30H29N5O4/c1-21-5-4-8-24(17-21)19-32-20-28(36)33-26-15-11-23(12-16-26)7-3-2-6-22-9-13-25(14-10-22)29(37)34-27(18-31)30(38)35-39/h4-5,8-17,27,32,39H,18-20,31H2,1H3,(H,33,36)(H,34,37)(H,35,38)/t27-/m0/s1 |
| InChIKey | DHDXVSZCOZJFIH-MHZLTWQESA-N |
| XLogP | 1.69 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|