C30H27FN4O5 — CID 59697269
4-[4-[4-[[2-[(3-fluorophenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 59697269) has the molecular formula C30H27FN4O5 and a molecular weight of 542.57 g/mol. Its IUPAC name is 4-[4-[4-[[2-[(3-fluorophenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[4-[4-[[2-[(3-fluorophenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59697269 |
| Molecular Formula | C30H27FN4O5 |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 4-[4-[4-[[2-[(3-fluorophenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(NC(=O)CNCc3cccc(F)c3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C30H27FN4O5/c1-20(36)28(30(39)35-40)34-29(38)24-13-9-21(10-14-24)5-2-3-6-22-11-15-26(16-12-22)33-27(37)19-32-18-23-7-4-8-25(31)17-23/h4,7-17,20,28,32,36,40H,18-19H2,1H3,(H,33,37)(H,34,38)(H,35,39)/t20-,28+/m1/s1 |
| InChIKey | DMTZIYXXWYIKSE-NGOKVRLYSA-N |
| XLogP | 1.94 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|