C31H31FN4O5 — CID 161091908
4-[4-[4-[[2-[(2-fluorophenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane (PubChem CID 161091908) has the molecular formula C31H31FN4O5 and a molecular weight of 558.61 g/mol. Its IUPAC name is 4-[4-[4-[[2-[(2-fluorophenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane.
| Compound Name | 4-[4-[4-[[2-[(2-fluorophenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane |
|---|---|
| PubChem CID | 161091908 |
| Molecular Formula | C31H31FN4O5 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 4-[4-[4-[[2-[(2-fluorophenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane |
| SMILES | C.C[C@@H](O)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(NC(=O)CNCc3ccccc3F)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C30H27FN4O5.CH4/c1-20(36)28(30(39)35-40)34-29(38)23-14-10-21(11-15-23)6-2-3-7-22-12-16-25(17-13-22)33-27(37)19-32-18-24-8-4-5-9-26(24)31;/h4-5,8-17,20,28,32,36,40H,18-19H2,1H3,(H,33,37)(H,34,38)(H,35,39);1H4/t20-,28+;/m1./s1 |
| InChIKey | UHHFLMKYUYVHKS-GBDMDELXSA-N |
| XLogP | 2.58 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|