C27H27F3N4O5 — CID 87199781
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[[2-[[2-(trifluoromethyl)phenyl]methylamino]acetyl]amino]phenyl]benzamide (PubChem CID 87199781) has the molecular formula C27H27F3N4O5 and a molecular weight of 544.53 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[[2-[[2-(trifluoromethyl)phenyl]methylamino]acetyl]amino]phenyl]benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[[2-[[2-(trifluoromethyl)phenyl]methylamino]acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 87199781 |
| Molecular Formula | C27H27F3N4O5 |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[[2-[[2-(trifluoromethyl)phenyl]methylamino]acetyl]amino]phenyl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(-c2ccc(NC(=O)CNCc3ccccc3C(F)(F)F)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C27H27F3N4O5/c1-16(35)24(26(38)34-39)33-25(37)19-8-6-17(7-9-19)18-10-12-21(13-11-18)32-23(36)15-31-14-20-4-2-3-5-22(20)27(28,29)30/h2-13,16,24,31,35,39H,14-15H2,1H3,(H,32,36)(H,33,37)(H,34,38)/t16-,24+/m1/s1 |
| InChIKey | HOMZEMGUYONPLG-GYCJOSAFSA-N |
| XLogP | 3.09 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|