C27H29ClN4O4 — CID 89141199
(2S,3R)-2-[1-[4-[4-[[2-[(2-chlorophenyl)methylamino]acetyl]amino]phenyl]phenyl]ethenylamino]-N,3-dihydroxybutanamide (PubChem CID 89141199) has the molecular formula C27H29ClN4O4 and a molecular weight of 509.01 g/mol. Its IUPAC name is (2S,3R)-2-[1-[4-[4-[[2-[(2-chlorophenyl)methylamino]acetyl]amino]phenyl]phenyl]ethenylamino]-N,3-dihydroxybutanamide.
| Compound Name | (2S,3R)-2-[1-[4-[4-[[2-[(2-chlorophenyl)methylamino]acetyl]amino]phenyl]phenyl]ethenylamino]-N,3-dihydroxybutanamide |
|---|---|
| PubChem CID | 89141199 |
| Molecular Formula | C27H29ClN4O4 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | (2S,3R)-2-[1-[4-[4-[[2-[(2-chlorophenyl)methylamino]acetyl]amino]phenyl]phenyl]ethenylamino]-N,3-dihydroxybutanamide |
| SMILES | C=C(N[C@H](C(=O)NO)[C@@H](C)O)c1ccc(-c2ccc(NC(=O)CNCc3ccccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C27H29ClN4O4/c1-17(30-26(18(2)33)27(35)32-36)19-7-9-20(10-8-19)21-11-13-23(14-12-21)31-25(34)16-29-15-22-5-3-4-6-24(22)28/h3-14,18,26,29-30,33,36H,1,15-16H2,2H3,(H,31,34)(H,32,35)/t18-,26+/m1/s1 |
| InChIKey | FBPBXIVJXJKDSS-DWXRJYCRSA-N |
| XLogP | 3.55 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|