C28H32N4O5 — CID 89141208
(2S,3R)-N,3-dihydroxy-2-[1-[4-[4-[[2-[(3-methoxyphenyl)methylamino]acetyl]amino]phenyl]phenyl]ethenylamino]butanamide (PubChem CID 89141208) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is (2S,3R)-N,3-dihydroxy-2-[1-[4-[4-[[2-[(3-methoxyphenyl)methylamino]acetyl]amino]phenyl]phenyl]ethenylamino]butanamide.
| Compound Name | (2S,3R)-N,3-dihydroxy-2-[1-[4-[4-[[2-[(3-methoxyphenyl)methylamino]acetyl]amino]phenyl]phenyl]ethenylamino]butanamide |
|---|---|
| PubChem CID | 89141208 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | (2S,3R)-N,3-dihydroxy-2-[1-[4-[4-[[2-[(3-methoxyphenyl)methylamino]acetyl]amino]phenyl]phenyl]ethenylamino]butanamide |
| SMILES | C=C(N[C@H](C(=O)NO)[C@@H](C)O)c1ccc(-c2ccc(NC(=O)CNCc3cccc(OC)c3)cc2)cc1 |
| InChI | InChI=1S/C28H32N4O5/c1-18(30-27(19(2)33)28(35)32-36)21-7-9-22(10-8-21)23-11-13-24(14-12-23)31-26(34)17-29-16-20-5-4-6-25(15-20)37-3/h4-15,19,27,29-30,33,36H,1,16-17H2,2-3H3,(H,31,34)(H,32,35)/t19-,27+/m1/s1 |
| InChIKey | TYQPGZNDUSZAPV-WINIVTDRSA-N |
| XLogP | 2.91 |
| TPSA | 131.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|