C26H29N5O6 — CID 88587202
N-[(1S,2S)-1-amino-1-hydroxy-3-(hydroxyamino)-3-oxopropan-2-yl]-4-[4-[[2-[(4-methoxyphenyl)methylamino]acetyl]amino]phenyl]benzamide (PubChem CID 88587202) has the molecular formula C26H29N5O6 and a molecular weight of 507.55 g/mol. Its IUPAC name is N-[(1S,2S)-1-amino-1-hydroxy-3-(hydroxyamino)-3-oxopropan-2-yl]-4-[4-[[2-[(4-methoxyphenyl)methylamino]acetyl]amino]phenyl]benzamide.
| Compound Name | N-[(1S,2S)-1-amino-1-hydroxy-3-(hydroxyamino)-3-oxopropan-2-yl]-4-[4-[[2-[(4-methoxyphenyl)methylamino]acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 88587202 |
| Molecular Formula | C26H29N5O6 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | N-[(1S,2S)-1-amino-1-hydroxy-3-(hydroxyamino)-3-oxopropan-2-yl]-4-[4-[[2-[(4-methoxyphenyl)methylamino]acetyl]amino]phenyl]benzamide |
| SMILES | COc1ccc(CNCC(=O)Nc2ccc(-c3ccc(C(=O)N[C@H](C(=O)NO)[C@@H](N)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H29N5O6/c1-37-21-12-2-16(3-13-21)14-28-15-22(32)29-20-10-8-18(9-11-20)17-4-6-19(7-5-17)25(34)30-23(24(27)33)26(35)31-36/h2-13,23-24,28,33,36H,14-15,27H2,1H3,(H,29,32)(H,30,34)(H,31,35)/t23-,24-/m0/s1 |
| InChIKey | GWOBOZUDBDRBME-ZEQRLZLVSA-N |
| XLogP | 0.97 |
| TPSA | 175.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|