C26H29N5O4S — CID 87199657
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[(4-methylsulfanylphenyl)methylamino]acetyl]amino]phenyl]benzamide (PubChem CID 87199657) has the molecular formula C26H29N5O4S and a molecular weight of 507.62 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[(4-methylsulfanylphenyl)methylamino]acetyl]amino]phenyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[(4-methylsulfanylphenyl)methylamino]acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 87199657 |
| Molecular Formula | C26H29N5O4S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[(4-methylsulfanylphenyl)methylamino]acetyl]amino]phenyl]benzamide |
| SMILES | CSc1ccc(CNCC(=O)Nc2ccc(-c3ccc(C(=O)N[C@@H](CN)C(=O)NO)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H29N5O4S/c1-36-22-12-2-17(3-13-22)15-28-16-24(32)29-21-10-8-19(9-11-21)18-4-6-20(7-5-18)25(33)30-23(14-27)26(34)31-35/h2-13,23,28,35H,14-16,27H2,1H3,(H,29,32)(H,30,33)(H,31,34)/t23-/m0/s1 |
| InChIKey | FXETWCVBRUTNAB-QHCPKHFHSA-N |
| XLogP | 2.37 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|