C28H29N5O6S — CID 59697345
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-[(4-methylsulfonylphenyl)methylamino]acetyl]amino]phenyl]ethynyl]benzamide (PubChem CID 59697345) has the molecular formula C28H29N5O6S and a molecular weight of 563.64 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-[(4-methylsulfonylphenyl)methylamino]acetyl]amino]phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-[(4-methylsulfonylphenyl)methylamino]acetyl]amino]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 59697345 |
| Molecular Formula | C28H29N5O6S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-[(4-methylsulfonylphenyl)methylamino]acetyl]amino]phenyl]ethynyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(CNCC(=O)Nc2ccc(C#Cc3ccc(C(=O)N[C@@H](CN)C(=O)NO)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H29N5O6S/c1-40(38,39)24-14-8-21(9-15-24)17-30-18-26(34)31-23-12-6-20(7-13-23)3-2-19-4-10-22(11-5-19)27(35)32-25(16-29)28(36)33-37/h4-15,25,30,37H,16-18,29H2,1H3,(H,31,34)(H,32,35)(H,33,36)/t25-/m0/s1 |
| InChIKey | FOCRLYFEFNNJDE-VWLOTQADSA-N |
| XLogP | 0.78 |
| TPSA | 179.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|