C27H34N6O4 — CID 157170354
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-[2-(dimethylamino)ethylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide;methane (PubChem CID 157170354) has the molecular formula C27H34N6O4 and a molecular weight of 506.61 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-[2-(dimethylamino)ethylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide;methane.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-[2-(dimethylamino)ethylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide;methane |
|---|---|
| PubChem CID | 157170354 |
| Molecular Formula | C27H34N6O4 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[[2-[2-(dimethylamino)ethylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide;methane |
| SMILES | C.CN(C)CCNCC(=O)Nc1ccc(C#CC#Cc2ccc(C(=O)N[C@@H](CN)C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C26H30N6O4.CH4/c1-32(2)16-15-28-18-24(33)29-22-13-9-20(10-14-22)6-4-3-5-19-7-11-21(12-8-19)25(34)30-23(17-27)26(35)31-36;/h7-14,23,28,36H,15-18,27H2,1-2H3,(H,29,33)(H,30,34)(H,31,35);1H4/t23-;/m0./s1 |
| InChIKey | ANJVOPAZBWUSLI-BQAIUKQQSA-N |
| XLogP | 0.38 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|