C25H33N5O4 — CID 158791221
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-(diethylamino)acetyl]amino]phenyl]ethynyl]benzamide;methane (PubChem CID 158791221) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-(diethylamino)acetyl]amino]phenyl]ethynyl]benzamide;methane.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-(diethylamino)acetyl]amino]phenyl]ethynyl]benzamide;methane |
|---|---|
| PubChem CID | 158791221 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-(diethylamino)acetyl]amino]phenyl]ethynyl]benzamide;methane |
| SMILES | C.CCN(CC)CC(=O)Nc1ccc(C#Cc2ccc(C(=O)N[C@@H](CN)C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C24H29N5O4.CH4/c1-3-29(4-2)16-22(30)26-20-13-9-18(10-14-20)6-5-17-7-11-19(12-8-17)23(31)27-21(15-25)24(32)28-33;/h7-14,21,33H,3-4,15-16,25H2,1-2H3,(H,26,30)(H,27,31)(H,28,32);1H4/t21-;/m0./s1 |
| InChIKey | ISHNMZAKKXPTIS-BOXHHOBZSA-N |
| XLogP | 1.57 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|