C21H22FN5O4 — CID 58670416
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-(3-aminopropanoylamino)phenyl]ethynyl]-3-fluorobenzamide (PubChem CID 58670416) has the molecular formula C21H22FN5O4 and a molecular weight of 427.44 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-(3-aminopropanoylamino)phenyl]ethynyl]-3-fluorobenzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-(3-aminopropanoylamino)phenyl]ethynyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 58670416 |
| Molecular Formula | C21H22FN5O4 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-(3-aminopropanoylamino)phenyl]ethynyl]-3-fluorobenzamide |
| SMILES | NCCC(=O)Nc1ccc(C#Cc2ccc(C(=O)N[C@@H](CN)C(=O)NO)cc2F)cc1 |
| InChI | InChI=1S/C21H22FN5O4/c22-17-11-15(20(29)26-18(12-24)21(30)27-31)6-5-14(17)4-1-13-2-7-16(8-3-13)25-19(28)9-10-23/h2-3,5-8,11,18,31H,9-10,12,23-24H2,(H,25,28)(H,26,29)(H,27,30)/t18-/m0/s1 |
| InChIKey | YICMCGGPZGVVSZ-SFHVURJKSA-N |
| XLogP | 0.08 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|