C27H25Cl2N5O4 — CID 59698263
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-[(3,4-dichlorophenyl)methylamino]acetyl]amino]phenyl]ethynyl]benzamide (PubChem CID 59698263) has the molecular formula C27H25Cl2N5O4 and a molecular weight of 554.43 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-[(3,4-dichlorophenyl)methylamino]acetyl]amino]phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-[(3,4-dichlorophenyl)methylamino]acetyl]amino]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 59698263 |
| Molecular Formula | C27H25Cl2N5O4 |
| Molecular Weight | 554.43 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-[(3,4-dichlorophenyl)methylamino]acetyl]amino]phenyl]ethynyl]benzamide |
| SMILES | NC[C@H](NC(=O)c1ccc(C#Cc2ccc(NC(=O)CNCc3ccc(Cl)c(Cl)c3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C27H25Cl2N5O4/c28-22-12-7-19(13-23(22)29)15-31-16-25(35)32-21-10-5-18(6-11-21)2-1-17-3-8-20(9-4-17)26(36)33-24(14-30)27(37)34-38/h3-13,24,31,38H,14-16,30H2,(H,32,35)(H,33,36)(H,34,37)/t24-/m0/s1 |
| InChIKey | IPESZAATRKGUNV-DEOSSOPVSA-N |
| XLogP | 2.68 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|