C27H28N4O3 — CID 59697830
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[(3-methylphenyl)methylamino]methyl]phenyl]ethynyl]benzamide (PubChem CID 59697830) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[(3-methylphenyl)methylamino]methyl]phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[(3-methylphenyl)methylamino]methyl]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 59697830 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[(3-methylphenyl)methylamino]methyl]phenyl]ethynyl]benzamide |
| SMILES | Cc1cccc(CNCc2ccc(C#Cc3ccc(C(=O)N[C@@H](CN)C(=O)NO)cc3)cc2)c1 |
| InChI | InChI=1S/C27H28N4O3/c1-19-3-2-4-23(15-19)18-29-17-22-9-7-20(8-10-22)5-6-21-11-13-24(14-12-21)26(32)30-25(16-28)27(33)31-34/h2-4,7-15,25,29,34H,16-18,28H2,1H3,(H,30,32)(H,31,33)/t25-/m0/s1 |
| InChIKey | VVRXETHEKACDPA-VWLOTQADSA-N |
| XLogP | 2.25 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|