C20H27N3O3 — CID 157286348
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-(4-methylphenyl)ethyl]benzamide;methane (PubChem CID 157286348) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-(4-methylphenyl)ethyl]benzamide;methane.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-(4-methylphenyl)ethyl]benzamide;methane |
|---|---|
| PubChem CID | 157286348 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-(4-methylphenyl)ethyl]benzamide;methane |
| SMILES | C.Cc1ccc(CCc2ccc(C(=O)N[C@@H](CN)C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C19H23N3O3.CH4/c1-13-2-4-14(5-3-13)6-7-15-8-10-16(11-9-15)18(23)21-17(12-20)19(24)22-25;/h2-5,8-11,17,25H,6-7,12,20H2,1H3,(H,21,23)(H,22,24);1H4/t17-;/m0./s1 |
| InChIKey | BAGWDZRVRINGEA-LMOVPXPDSA-N |
| XLogP | 1.98 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|