C22H28N4O3 — CID 87199719
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[(cyclopentylamino)methyl]phenyl]benzamide (PubChem CID 87199719) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[(cyclopentylamino)methyl]phenyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[(cyclopentylamino)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 87199719 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[(cyclopentylamino)methyl]phenyl]benzamide |
| SMILES | NC[C@H](NC(=O)c1ccc(-c2ccc(CNC3CCCC3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C22H28N4O3/c23-13-20(22(28)26-29)25-21(27)18-11-9-17(10-12-18)16-7-5-15(6-8-16)14-24-19-3-1-2-4-19/h5-12,19-20,24,29H,1-4,13-14,23H2,(H,25,27)(H,26,28)/t20-/m0/s1 |
| InChIKey | WLSNINPATNPNEJ-FQEVSTJZSA-N |
| XLogP | 1.95 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|