C26H35N5O4 — CID 87199619
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]phenyl]benzamide (PubChem CID 87199619) has the molecular formula C26H35N5O4 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]phenyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 87199619 |
| Molecular Formula | C26H35N5O4 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]phenyl]benzamide |
| SMILES | CC1CCCC(NCC(=O)Nc2ccc(-c3ccc(C(=O)N[C@@H](CN)C(=O)NO)cc3)cc2)C1C |
| InChI | InChI=1S/C26H35N5O4/c1-16-4-3-5-22(17(16)2)28-15-24(32)29-21-12-10-19(11-13-21)18-6-8-20(9-7-18)25(33)30-23(14-27)26(34)31-35/h6-13,16-17,22-23,28,35H,3-5,14-15,27H2,1-2H3,(H,29,32)(H,30,33)(H,31,34)/t16?,17?,22?,23-/m0/s1 |
| InChIKey | MHBWLKBQFJQUPN-MFVBDYKBSA-N |
| XLogP | 2.27 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|