C27H36N4O5 — CID 87199569
4-[4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 87199569) has the molecular formula C27H36N4O5 and a molecular weight of 496.61 g/mol. Its IUPAC name is 4-[4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 87199569 |
| Molecular Formula | C27H36N4O5 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 4-[4-[[2-[(2,3-dimethylcyclohexyl)amino]acetyl]amino]phenyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | CC1CCCC(NCC(=O)Nc2ccc(-c3ccc(C(=O)N[C@H](C(=O)NO)[C@@H](C)O)cc3)cc2)C1C |
| InChI | InChI=1S/C27H36N4O5/c1-16-5-4-6-23(17(16)2)28-15-24(33)29-22-13-11-20(12-14-22)19-7-9-21(10-8-19)26(34)30-25(18(3)32)27(35)31-36/h7-14,16-18,23,25,28,32,36H,4-6,15H2,1-3H3,(H,29,33)(H,30,34)(H,31,35)/t16?,17?,18-,23?,25+/m1/s1 |
| InChIKey | WUOYLLVDMBAKKH-PTRCHQJKSA-N |
| XLogP | 2.69 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|