C28H33N5O5 — CID 59697023
4-[2-[4-[[2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]amino]acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 59697023) has the molecular formula C28H33N5O5 and a molecular weight of 519.60 g/mol. Its IUPAC name is 4-[2-[4-[[2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]amino]acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[2-[4-[[2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]amino]acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59697023 |
| Molecular Formula | C28H33N5O5 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | 4-[2-[4-[[2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]amino]acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(C#Cc2ccc(NC(=O)CN[C@H]3CN4CCC3CC4)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C28H33N5O5/c1-18(34)26(28(37)32-38)31-27(36)22-8-4-19(5-9-22)2-3-20-6-10-23(11-7-20)30-25(35)16-29-24-17-33-14-12-21(24)13-15-33/h4-11,18,21,24,26,29,34,38H,12-17H2,1H3,(H,30,35)(H,31,36)(H,32,37)/t18-,24+,26+/m1/s1 |
| InChIKey | PJWLIVRNHUDKFE-VAQLEPBLSA-N |
| XLogP | 0.69 |
| TPSA | 143.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|