C25H26N4O6 — CID 59698282
4-[4-[4-[[2-(2-hydroxyethylamino)acetyl]amino]phenyl]buta-1,3-diynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 59698282) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is 4-[4-[4-[[2-(2-hydroxyethylamino)acetyl]amino]phenyl]buta-1,3-diynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[4-[4-[[2-(2-hydroxyethylamino)acetyl]amino]phenyl]buta-1,3-diynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59698282 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 4-[4-[4-[[2-(2-hydroxyethylamino)acetyl]amino]phenyl]buta-1,3-diynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(NC(=O)CNCCO)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C25H26N4O6/c1-17(31)23(25(34)29-35)28-24(33)20-10-6-18(7-11-20)4-2-3-5-19-8-12-21(13-9-19)27-22(32)16-26-14-15-30/h6-13,17,23,26,30-31,35H,14-16H2,1H3,(H,27,32)(H,28,33)(H,29,34)/t17-,23+/m1/s1 |
| InChIKey | KJLLGLNPDMENKR-HXOBKFHXSA-N |
| XLogP | -0.41 |
| TPSA | 160.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|