C26H34N4O6 — CID 157379160
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-[4-[[2-(3-methoxypropylamino)acetyl]amino]phenyl]ethynyl]benzamide;methane (PubChem CID 157379160) has the molecular formula C26H34N4O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-[4-[[2-(3-methoxypropylamino)acetyl]amino]phenyl]ethynyl]benzamide;methane.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-[4-[[2-(3-methoxypropylamino)acetyl]amino]phenyl]ethynyl]benzamide;methane |
|---|---|
| PubChem CID | 157379160 |
| Molecular Formula | C26H34N4O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-[4-[[2-(3-methoxypropylamino)acetyl]amino]phenyl]ethynyl]benzamide;methane |
| SMILES | C.COCCCNCC(=O)Nc1ccc(C#Cc2ccc(C(=O)N[C@H](C(=O)NO)[C@@H](C)O)cc2)cc1 |
| InChI | InChI=1S/C25H30N4O6.CH4/c1-17(30)23(25(33)29-34)28-24(32)20-10-6-18(7-11-20)4-5-19-8-12-21(13-9-19)27-22(31)16-26-14-3-15-35-2;/h6-13,17,23,26,30,34H,3,14-16H2,1-2H3,(H,27,31)(H,28,32)(H,29,33);1H4/t17-,23+;/m1./s1 |
| InChIKey | BKRBCEGRSOLJHA-KAPRSBACSA-N |
| XLogP | 1.27 |
| TPSA | 149.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|