C30H33FN4O5 — CID 157438766
4-[2-[4-[[2-[2-(4-fluorophenyl)ethylamino]acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane (PubChem CID 157438766) has the molecular formula C30H33FN4O5 and a molecular weight of 548.62 g/mol. Its IUPAC name is 4-[2-[4-[[2-[2-(4-fluorophenyl)ethylamino]acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane.
| Compound Name | 4-[2-[4-[[2-[2-(4-fluorophenyl)ethylamino]acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane |
|---|---|
| PubChem CID | 157438766 |
| Molecular Formula | C30H33FN4O5 |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 4-[2-[4-[[2-[2-(4-fluorophenyl)ethylamino]acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane |
| SMILES | C.C[C@@H](O)[C@H](NC(=O)c1ccc(C#Cc2ccc(NC(=O)CNCCc3ccc(F)cc3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C29H29FN4O5.CH4/c1-19(35)27(29(38)34-39)33-28(37)23-10-4-20(5-11-23)2-3-21-8-14-25(15-9-21)32-26(36)18-31-17-16-22-6-12-24(30)13-7-22;/h4-15,19,27,31,35,39H,16-18H2,1H3,(H,32,36)(H,33,37)(H,34,38);1H4/t19-,27+;/m1./s1 |
| InChIKey | BRKMRHIVUNCGLF-ZLRSFIRASA-N |
| XLogP | 2.62 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|