C25H27N5O5 — CID 149371734
4-[2-[4-[[2-[2-(2H-azirin-2-yl)ethylamino]acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 149371734) has the molecular formula C25H27N5O5 and a molecular weight of 477.52 g/mol. Its IUPAC name is 4-[2-[4-[[2-[2-(2H-azirin-2-yl)ethylamino]acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[2-[4-[[2-[2-(2H-azirin-2-yl)ethylamino]acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 149371734 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 4-[2-[4-[[2-[2-(2H-azirin-2-yl)ethylamino]acetyl]amino]phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(C#Cc2ccc(NC(=O)CNCCC3C=N3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C25H27N5O5/c1-16(31)23(25(34)30-35)29-24(33)19-8-4-17(5-9-19)2-3-18-6-10-20(11-7-18)28-22(32)15-26-13-12-21-14-27-21/h4-11,14,16,21,23,26,31,35H,12-13,15H2,1H3,(H,28,32)(H,29,33)(H,30,34)/t16-,21?,23+/m1/s1 |
| InChIKey | YJYCJYJIGMMYGJ-WRCFPPIZSA-N |
| XLogP | 0.44 |
| TPSA | 152.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|