C31H30N4O6 — CID 59697115
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[4-[[2-[(2-methoxyphenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide (PubChem CID 59697115) has the molecular formula C31H30N4O6 and a molecular weight of 554.60 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[4-[[2-[(2-methoxyphenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[4-[[2-[(2-methoxyphenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 59697115 |
| Molecular Formula | C31H30N4O6 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[4-[[2-[(2-methoxyphenyl)methylamino]acetyl]amino]phenyl]buta-1,3-diynyl]benzamide |
| SMILES | COc1ccccc1CNCC(=O)Nc1ccc(C#CC#Cc2ccc(C(=O)N[C@H](C(=O)NO)[C@@H](C)O)cc2)cc1 |
| InChI | InChI=1S/C31H30N4O6/c1-21(36)29(31(39)35-40)34-30(38)24-15-11-22(12-16-24)7-3-4-8-23-13-17-26(18-14-23)33-28(37)20-32-19-25-9-5-6-10-27(25)41-2/h5-6,9-18,21,29,32,36,40H,19-20H2,1-2H3,(H,33,37)(H,34,38)(H,35,39)/t21-,29+/m1/s1 |
| InChIKey | AXBYCXGXRKEVOZ-PBBNMVCDSA-N |
| XLogP | 1.81 |
| TPSA | 149.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|