C25H31N5O4 — CID 89141214
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]amino]acetyl]amino]phenyl]benzamide (PubChem CID 89141214) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]amino]acetyl]amino]phenyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]amino]acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 89141214 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]amino]acetyl]amino]phenyl]benzamide |
| SMILES | NC[C@H](NC(=O)c1ccc(-c2ccc(NC(=O)CN[C@@H]3C[C@@H]4CC[C@@H]3C4)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C25H31N5O4/c26-13-22(25(33)30-34)29-24(32)18-5-3-16(4-6-18)17-7-9-20(10-8-17)28-23(31)14-27-21-12-15-1-2-19(21)11-15/h3-10,15,19,21-22,27,34H,1-2,11-14,26H2,(H,28,31)(H,29,32)(H,30,33)/t15-,19-,21-,22+/m1/s1 |
| InChIKey | FZGAIVJUOCQFJC-PYYHNFOQSA-N |
| XLogP | 1.63 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|