C27H34N4O3 — CID 161333177
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]methyl]phenyl]ethynyl]benzamide;methane (PubChem CID 161333177) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]methyl]phenyl]ethynyl]benzamide;methane.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]methyl]phenyl]ethynyl]benzamide;methane |
|---|---|
| PubChem CID | 161333177 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]methyl]phenyl]ethynyl]benzamide;methane |
| SMILES | C.NC[C@H](NC(=O)c1ccc(C#Cc2ccc(CN[C@@H]3C[C@H]4CC[C@@H]3C4)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C26H30N4O3.CH4/c27-15-24(26(32)30-33)29-25(31)21-10-7-18(8-11-21)2-1-17-3-5-19(6-4-17)16-28-23-14-20-9-12-22(23)13-20;/h3-8,10-11,20,22-24,28,33H,9,12-16,27H2,(H,29,31)(H,30,32);1H4/t20-,22+,23+,24-;/m0./s1 |
| InChIKey | VLRNMKLMBGOSLR-ZMQZINMSSA-N |
| XLogP | 2.56 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|