C27H31N5O4 — CID 87103030
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]acetyl]amino]phenyl]ethynyl]benzamide (PubChem CID 87103030) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]acetyl]amino]phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]acetyl]amino]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 87103030 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[[2-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]acetyl]amino]phenyl]ethynyl]benzamide |
| SMILES | NC[C@H](NC(=O)c1ccc(C#Cc2ccc(NC(=O)CNC3C[C@H]4CC[C@H]3C4)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C27H31N5O4/c28-15-24(27(35)32-36)31-26(34)20-8-3-17(4-9-20)1-2-18-6-11-22(12-7-18)30-25(33)16-29-23-14-19-5-10-21(23)13-19/h3-4,6-9,11-12,19,21,23-24,29,36H,5,10,13-16,28H2,(H,30,33)(H,31,34)(H,32,35)/t19-,21-,23?,24-/m0/s1 |
| InChIKey | UZHGBCWNTRAAEW-MHFQOHMYSA-N |
| XLogP | 1.37 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|