C28H25N5O4 — CID 59697250
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[(2-anilinoacetyl)amino]phenyl]buta-1,3-diynyl]benzamide (PubChem CID 59697250) has the molecular formula C28H25N5O4 and a molecular weight of 495.54 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[(2-anilinoacetyl)amino]phenyl]buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[(2-anilinoacetyl)amino]phenyl]buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 59697250 |
| Molecular Formula | C28H25N5O4 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[4-[(2-anilinoacetyl)amino]phenyl]buta-1,3-diynyl]benzamide |
| SMILES | NC[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(NC(=O)CNc3ccccc3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C28H25N5O4/c29-18-25(28(36)33-37)32-27(35)22-14-10-20(11-15-22)6-4-5-7-21-12-16-24(17-13-21)31-26(34)19-30-23-8-2-1-3-9-23/h1-3,8-17,25,30,37H,18-19,29H2,(H,31,34)(H,32,35)(H,33,36)/t25-/m0/s1 |
| InChIKey | ORLANCOKIDRCES-VWLOTQADSA-N |
| XLogP | 1.70 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|