C24H30N4O4 — CID 89279585
N-[(1S,2S)-1-amino-1-hydroxy-3-(hydroxyamino)-3-oxopropan-2-yl]-4-[4-[[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]methyl]phenyl]benzamide (PubChem CID 89279585) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-[(1S,2S)-1-amino-1-hydroxy-3-(hydroxyamino)-3-oxopropan-2-yl]-4-[4-[[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]methyl]phenyl]benzamide.
| Compound Name | N-[(1S,2S)-1-amino-1-hydroxy-3-(hydroxyamino)-3-oxopropan-2-yl]-4-[4-[[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 89279585 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N-[(1S,2S)-1-amino-1-hydroxy-3-(hydroxyamino)-3-oxopropan-2-yl]-4-[4-[[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]amino]methyl]phenyl]benzamide |
| SMILES | N[C@@H](O)[C@H](NC(=O)c1ccc(-c2ccc(CN[C@@H]3C[C@H]4CC[C@@H]3C4)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C24H30N4O4/c25-22(29)21(24(31)28-32)27-23(30)18-9-7-17(8-10-18)16-4-1-14(2-5-16)13-26-20-12-15-3-6-19(20)11-15/h1-2,4-5,7-10,15,19-22,26,29,32H,3,6,11-13,25H2,(H,27,30)(H,28,31)/t15-,19+,20+,21-,22-/m0/s1 |
| InChIKey | MLPJRLCQHOPCIS-MCBQPRCJSA-N |
| XLogP | 1.51 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|