C22H30N6O4 — CID 87199550
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[2-(dimethylamino)ethylamino]acetyl]amino]phenyl]benzamide (PubChem CID 87199550) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[2-(dimethylamino)ethylamino]acetyl]amino]phenyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[2-(dimethylamino)ethylamino]acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 87199550 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[2-(dimethylamino)ethylamino]acetyl]amino]phenyl]benzamide |
| SMILES | CN(C)CCNCC(=O)Nc1ccc(-c2ccc(C(=O)N[C@@H](CN)C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C22H30N6O4/c1-28(2)12-11-24-14-20(29)25-18-9-7-16(8-10-18)15-3-5-17(6-4-15)21(30)26-19(13-23)22(31)27-32/h3-10,19,24,32H,11-14,23H2,1-2H3,(H,25,29)(H,26,30)(H,27,31)/t19-/m0/s1 |
| InChIKey | OQSZSVNARBCOLF-IBGZPJMESA-N |
| XLogP | 0.01 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|