C26H25F4N5O4 — CID 87310318
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]acetyl]amino]phenyl]benzamide (PubChem CID 87310318) has the molecular formula C26H25F4N5O4 and a molecular weight of 547.51 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]acetyl]amino]phenyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 87310318 |
| Molecular Formula | C26H25F4N5O4 |
| Molecular Weight | 547.51 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[4-[[2-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]acetyl]amino]phenyl]benzamide |
| SMILES | NC[C@H](NC(=O)c1ccc(-c2ccc(NC(=O)CNCc3ccc(F)cc3C(F)(F)F)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C26H25F4N5O4/c27-19-8-5-18(21(11-19)26(28,29)30)13-32-14-23(36)33-20-9-6-16(7-10-20)15-1-3-17(4-2-15)24(37)34-22(12-31)25(38)35-39/h1-11,22,32,39H,12-14,31H2,(H,33,36)(H,34,37)(H,35,38)/t22-/m0/s1 |
| InChIKey | DUGGCVPWGBDDNF-QFIPXVFZSA-N |
| XLogP | 2.80 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|