C29H26F4N4O5 — CID 91013218
4-[2-[4-[[2-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]acetyl]amino]phenyl]ethynyl]-N-[2-hydroxy-4-(hydroxyamino)-4-oxobutyl]benzamide (PubChem CID 91013218) has the molecular formula C29H26F4N4O5 and a molecular weight of 586.54 g/mol. Its IUPAC name is 4-[2-[4-[[2-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]acetyl]amino]phenyl]ethynyl]-N-[2-hydroxy-4-(hydroxyamino)-4-oxobutyl]benzamide.
| Compound Name | 4-[2-[4-[[2-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]acetyl]amino]phenyl]ethynyl]-N-[2-hydroxy-4-(hydroxyamino)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 91013218 |
| Molecular Formula | C29H26F4N4O5 |
| Molecular Weight | 586.54 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | 4-[2-[4-[[2-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]acetyl]amino]phenyl]ethynyl]-N-[2-hydroxy-4-(hydroxyamino)-4-oxobutyl]benzamide |
| SMILES | O=C(CC(O)CNC(=O)c1ccc(C#Cc2ccc(NC(=O)CNCc3ccc(F)cc3C(F)(F)F)cc2)cc1)NO |
| InChI | InChI=1S/C29H26F4N4O5/c30-22-10-9-21(25(13-22)29(31,32)33)15-34-17-27(40)36-23-11-5-19(6-12-23)2-1-18-3-7-20(8-4-18)28(41)35-16-24(38)14-26(39)37-42/h3-13,24,34,38,42H,14-17H2,(H,35,41)(H,36,40)(H,37,39) |
| InChIKey | AEDZNKWNDGUSBX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|