C16H18N4O3 — CID 89048095
N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-pyridin-4-ylbenzamide (PubChem CID 89048095) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-pyridin-4-ylbenzamide.
| Compound Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 89048095 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-pyridin-4-ylbenzamide |
| SMILES | C[C@@H](N)[C@H](NC(=O)c1ccc(-c2ccncc2)cc1)C(=O)NO |
| InChI | InChI=1S/C16H18N4O3/c1-10(17)14(16(22)20-23)19-15(21)13-4-2-11(3-5-13)12-6-8-18-9-7-12/h2-10,14,23H,17H2,1H3,(H,19,21)(H,20,22)/t10-,14+/m1/s1 |
| InChIKey | KVXROLBUKKWEMK-YGRLFVJLSA-N |
| XLogP | 0.70 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|