C16H11F5N2O3 — CID 59162848
4-(3,5-difluorophenyl)-N-[1,1,1-trifluoro-3-(hydroxyamino)-3-oxopropan-2-yl]benzamide (PubChem CID 59162848) has the molecular formula C16H11F5N2O3 and a molecular weight of 374.27 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-N-[1,1,1-trifluoro-3-(hydroxyamino)-3-oxopropan-2-yl]benzamide.
| Compound Name | 4-(3,5-difluorophenyl)-N-[1,1,1-trifluoro-3-(hydroxyamino)-3-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 59162848 |
| Molecular Formula | C16H11F5N2O3 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 4-(3,5-difluorophenyl)-N-[1,1,1-trifluoro-3-(hydroxyamino)-3-oxopropan-2-yl]benzamide |
| SMILES | O=C(NC(C(=O)NO)C(F)(F)F)c1ccc(-c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C16H11F5N2O3/c17-11-5-10(6-12(18)7-11)8-1-3-9(4-2-8)14(24)22-13(15(25)23-26)16(19,20)21/h1-7,13,26H,(H,22,24)(H,23,25) |
| InChIKey | YWSFJROJNSDHLJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|