C22H17F3N2O4 — CID 155523825
N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]-4-methoxybenzamide (PubChem CID 155523825) has the molecular formula C22H17F3N2O4 and a molecular weight of 430.38 g/mol. Its IUPAC name is N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 155523825 |
| Molecular Formula | C22H17F3N2O4 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(C(=O)NO)c2ccc(-c3cc(F)c(F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C22H17F3N2O4/c1-31-16-8-6-14(7-9-16)21(28)26-20(22(29)27-30)13-4-2-12(3-5-13)15-10-17(23)19(25)18(24)11-15/h2-11,20,30H,1H3,(H,26,28)(H,27,29) |
| InChIKey | PBIOEOSFIKEHDH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|