C24H20F3N3O4 — CID 155514541
1-N-ethyl-4-N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]benzene-1,4-dicarboxamide (PubChem CID 155514541) has the molecular formula C24H20F3N3O4 and a molecular weight of 471.44 g/mol. Its IUPAC name is 1-N-ethyl-4-N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N-ethyl-4-N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 155514541 |
| Molecular Formula | C24H20F3N3O4 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 1-N-ethyl-4-N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]benzene-1,4-dicarboxamide |
| SMILES | CCNC(=O)c1ccc(C(=O)NC(C(=O)NO)c2ccc(-c3cc(F)c(F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C24H20F3N3O4/c1-2-28-22(31)15-7-9-16(10-8-15)23(32)29-21(24(33)30-34)14-5-3-13(4-6-14)17-11-18(25)20(27)19(26)12-17/h3-12,21,34H,2H2,1H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | MZZBOHICJZVFST-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|