C23H16F3N3O4 — CID 155568852
N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]-2-oxo-1,3-dihydroindole-5-carboxamide (PubChem CID 155568852) has the molecular formula C23H16F3N3O4 and a molecular weight of 455.39 g/mol. Its IUPAC name is N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]-2-oxo-1,3-dihydroindole-5-carboxamide.
| Compound Name | N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]-2-oxo-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 155568852 |
| Molecular Formula | C23H16F3N3O4 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[2-(hydroxyamino)-2-oxo-1-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]-2-oxo-1,3-dihydroindole-5-carboxamide |
| SMILES | O=C1Cc2cc(C(=O)NC(C(=O)NO)c3ccc(-c4cc(F)c(F)c(F)c4)cc3)ccc2N1 |
| InChI | InChI=1S/C23H16F3N3O4/c24-16-8-14(9-17(25)20(16)26)11-1-3-12(4-2-11)21(23(32)29-33)28-22(31)13-5-6-18-15(7-13)10-19(30)27-18/h1-9,21,33H,10H2,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | JCNZBSYWEFVNJC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|