C14H16N2O2 — CID 113237405
2-oxo-N-pent-4-en-2-yl-1,3-dihydroindole-5-carboxamide (PubChem CID 113237405) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-oxo-N-pent-4-en-2-yl-1,3-dihydroindole-5-carboxamide.
| Compound Name | 2-oxo-N-pent-4-en-2-yl-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 113237405 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2-oxo-N-pent-4-en-2-yl-1,3-dihydroindole-5-carboxamide |
| SMILES | C=CCC(C)NC(=O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C14H16N2O2/c1-3-4-9(2)15-14(18)10-5-6-12-11(7-10)8-13(17)16-12/h3,5-7,9H,1,4,8H2,2H3,(H,15,18)(H,16,17) |
| InChIKey | OMGWARBOHBAOGV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|