C15H9F3N2O2 — CID 110700473
2-oxo-N-(2,3,4-trifluorophenyl)-1,3-dihydroindole-5-carboxamide (PubChem CID 110700473) has the molecular formula C15H9F3N2O2 and a molecular weight of 306.24 g/mol. Its IUPAC name is 2-oxo-N-(2,3,4-trifluorophenyl)-1,3-dihydroindole-5-carboxamide.
| Compound Name | 2-oxo-N-(2,3,4-trifluorophenyl)-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 110700473 |
| Molecular Formula | C15H9F3N2O2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-oxo-N-(2,3,4-trifluorophenyl)-1,3-dihydroindole-5-carboxamide |
| SMILES | O=C1Cc2cc(C(=O)Nc3ccc(F)c(F)c3F)ccc2N1 |
| InChI | InChI=1S/C15H9F3N2O2/c16-9-2-4-11(14(18)13(9)17)20-15(22)7-1-3-10-8(5-7)6-12(21)19-10/h1-5H,6H2,(H,19,21)(H,20,22) |
| InChIKey | TTXCHWZHYXNTRY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|