C17H13ClN2O4 — CID 110700432
methyl 4-chloro-3-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]benzoate (PubChem CID 110700432) has the molecular formula C17H13ClN2O4 and a molecular weight of 344.75 g/mol. Its IUPAC name is methyl 4-chloro-3-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]benzoate.
| Compound Name | methyl 4-chloro-3-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110700432 |
| Molecular Formula | C17H13ClN2O4 |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | methyl 4-chloro-3-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)c2ccc3c(c2)CC(=O)N3)c1 |
| InChI | InChI=1S/C17H13ClN2O4/c1-24-17(23)10-2-4-12(18)14(7-10)20-16(22)9-3-5-13-11(6-9)8-15(21)19-13/h2-7H,8H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | OQPCUFMVVBCKSX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |